Phương pháp giải bài tập về este đa chức

Kim VnK

Cộng tác viên
Thành viên BQT
Este đa chức là một dạng bài hay có trong các đề thi và đặc biệt đó là chất béo (este ba chức). Ngoài ra, còn là bài tập este tìm chất quan trọng. Để làm được dạng bài này, chúng ta cần phải hiểu este đa chức là gì ? Nó khác gì so với este đơn chức thông thường và nó có những khó khăn gì cho người học ? Sau đây, là những kiến thức cơ bản về este đa chức và dạng bài tập liên quan.

1. Một số công thức tổng quát của este đa chức

Este tạo thành từ axit đơn chức và ancol đa chức (n chức): (RCOO)nR’ Este tạo thành từ axit đa chức (n chức) và ancol đơn chức: R(COOR’)n
Este tạo thành từ axit đa chức (n chức) và ancol đa chức (m chức): Rm(COO)m.nR’n

Khi n = m thành R(COO)nR’ ⇒ este vòng

Este no, 2 chức, mạch hở: CnH2n-2O4

2. Phản ứng xà phòng hóa

x là số nhóm chức este
bai-tap-ve-este-da-chuc-1.png


- Khi xà phòng hóa este 2 chức với dung dịch NaOH cho:

1 muối + 1 ancol + 1 anđehit thì este đó có cấu tạo: R1 - OOC-R-COO-CH=CH-R2

R1-OOC-R-COO-CH=CH-R2 + 2NaOH => NaOOC-R-COONa + R1OH + R2CH2CHO

2 muối + 1 ancol thì este đó có cấu tạo: R1 - COO-R-OOC-R2

R1 - COO-R-OOC-R2 + 2NaOH => R1 – COONa + R2COONa + R(OH)2

Ta có: nOH- = 2neste = Σnmuối; nancol = neste

1 muối + 2 ancol thì este đó có cấu tạo: R1OOC-R-COOR2

Phản ứng:

R1-OOC-R-COOR2 + 2NaOH => NaOOC-R-COONa + R1OH + R2OH

Ta có: nOH- = 2nmuối = 2neste; nOH- = 2 Σnrượu.

1 muối + 1 ancol thì este đó có cấu tạo: R(COOR’)2 hoặc (RCOO)2R’

Phản ứng:

R(COOR')2 + 2NaoH => NaOOC-R-COONa + 2R'OH

(RCOO)2R' + 2NaOH => 2RCOONa + R'(OH)2

3. Ví dụ minh họa bài tập về Este đa chức

Ví dụ 1: Chất A có CTPT là C11H20O4. A tác dụng với NaOH tạo ra muối của axit hữu cơ B mạch thẳng và 2 ancol là etanol và propanol-2. Hãy viết CTCT của A.

Đáp án hướng dẫn giải chi tiết

A: C11H20O4 + NaOH muối + C2H5OH + CH3-CHOH-CH3

⇒ A là este tạo nên từ axit no 2 chức và 2 ancol trên

⇒ CTCT của A là: C2H5OOC-CH2-CH2-CH2-CH2-COO-CH-(CH3)2

Ví dụ 2: Để thủy phân 0,1 mol este A chỉ chứa 1 loại nhóm chức cần dùng vừa đủ 100gam dd NaOH 12%, thu được 20,4 gam muối của một axit hữu cơ và 9,2 gam một ancol. Xác định CTPT, viết CTCT và gọi tên este đó. Biết 1 trong 2 chất (ancol hoặc axit) tạo thành este là đơn chức

Đáp án hướng dẫn giải chi tiết

nX : nNaOH = 1 : 3

Do ancol đa chức và muối của axit hữu cơ

⇒ X là este 3 chức (RCOO)3R'

⇒ nancol = nX = 0,1 mol ⇒ Mancol = R' + 17 × 3 = 92 ⇒ R = 41 (C3H5)

mmuối = 3nX = 0,3 mol ⇒ Mmuối = R + 67 = 68 ⇒ R = 1 (H)

X là (HCOO)3C3H5: Glixerol trifomiat

trifomiat

Ví dụ 3: Để thuỷ phân hết 7,612 gam hỗn hợp X gồm 2 este đơn chức và 2 este đa chức thì cần dùng vừa hết 80ml dung dịch KOH aM. Sau phản ứng, thu được hỗn hợp Y gồm các muối của các axit cacboxylic và các ancol. Đốt cháy hoàn toàn hỗn hợp Y thì thu được K2CO3, 4,4352 lít CO2 (đktc) và 3,168 gam H2O. Vậy a có giá trị là bao nhiêu?

Đáp án hướng dẫn giải bài tập

Thủy phân: 7,612 gam X + 2x mol KOH → Y (gồm cả muối + ancol).

Đốt Y + O2 → x mol K2CO3 + 0,198 mol CO2 + 0,176 mol H2O.

+ Bảo toàn C có nC trong X = nC trong Y = 0,198 + x mol.

+ Bảo toàn H có nH trong X = nH trong Y – nH trong KOH = 0,352 – 2x mol.

+ O trong X theo cụm –COO mà n–COO = nKOH = 2x mol → nO trong X = 4x mol.

Tổng lại: mX = mC + mH + mO = 7,612 gam. Thay vào giải x = 0,066 mol.

→ nKOH = 2x = 0,132 mol → a = 0,132 : 0,08 = 1,65M.

Ví dụ 4. Cho 0,01 mol một este X của axit hữu cơ phản ứng vừa đủ với 100 ml dung dịch NaOH 0,2 M, sản phẩm tạo thành chỉ gồm một ancol Y và một muối Z với số mol bằng nhau. Mặt khác, khi xà phòng hoá hoàn toàn 1,29 gam este đó bằng một lượng vừa đủ là 60 ml dung dịch KOH 0,25 M, sau khi phản ứng kết thúc đem cô cạn dung dịch được 1,665 gam muối khan. Công thức của este X là:

A. C2H4(COO)2C4H8

B. C4H8(COO)2C2H4

C. C2H4(COOC4H9)2

D. C4H8(COOC2H5)2

Đáp án hướng dẫn hướng dẫn giải

Ta có: nZ = nY ⇒ X chỉ chứa chức este

Sỗ nhóm chức este là: nNaOH/nX = (0,1.0,2)/0,01 = 2 => CT của X có dạng: R(COO)2R'

Từ phản ứng thủy phân: naxit = n muối = 1/2 nKOH = 1/2.0,06.0,25 = 0,0075 mol

M este = 1,29/0,0075 = 172 => 172 => R + 2,44 + R' = 172 => R' = 28

Vậy X C4H8(COO)2C2H4

Đáp án B

Ví dụ 5. Hợp chất hữu cơ X chứa một loại nhóm chức có CTPT là C8H14O4. Khi thủy phân X trong dung dịch NaOH thu được một muối và hỗn hợp hai ancol A và B. Phân tử ancol B có số nguyên tử cacbon nhiều gấp đôi trong A. Khi đun nóng với H2SO4 đặc, A cho một anken và B cho 2 anken. Tìm CTCT của X

Đáp án hướng dẫn giải chi tiết

X + NaOH → 1 muối + 2 ancol => X: R1OOC-R-COOR2

A, B đều tạo ra anken => A, B phải có ít nhất 2 nguyên tử C

X có 8C, có 2 nhóm –COO, B có số C gấp đôi số C của A => A có 2C (C2H5OH) và B có 4C (C4H9OH) có CTCT: CH3-CHOH-CH2CH3

Axít tạo ra este là axit oxalic: HOOC-COOH

Ví dụ 6: Hai este A và B là dẫn xuất của benzen có công thức phân tử là C9H8O2. A và B đều cộng hợp với Br2 tỉ lệ mol 1 : 1. A tác dụng với dung dịch NaOH cho 1 muối và 1 andehit. B tác dụng với dung dịch NaOH dư cho 2 muối và H2O. Công thức cấu tạo của A và B lần lượt là:

A. HOOC-C6H4-CH=CH2 và CH2=CH-COOC6H5.

B. C6H5COOCH=CH2 và C6H5-CH=CH-COOH.

C. HOOC-C6H4-CH=CH2 và HCOOCH=CH-C6H5.

D. C6H5COOCH-CH2 và CH2=CH-COOC6H5.

Đáp án hướng dẫn giải chi tiết

A, B đều phản ứng cộng với Br2 tỉ lệ mol 1 : 1 ⇒ có 1 liên kết C=C.

A + NaOH → muối + andehit ⇒ A là este với gốc hidrocacbon anco có liên kết C=C gắn với -COO- dạng RCOO-CH=CH-R’.

⇒ Loại A.

B + NaOH dư → 2 muối và H2O ⇒ B là este của phenol RCOO-C6H4-R’.

Trên đây, là những kiến thức cơ bản và cần thiết về este đa chức. Với bài viết này, bạn sẽ có tiền đề để giải quyết các bài toán este nói chung và este đơn chức, chất béo nói riêng. Chúc bạn sẽ vượt qua kì thi thật tốt !
 
CHAT
  1. VHT BOOKS @ VHT BOOKS: Thế mà đã giữa tháng 11 rồi đấy nhỉ?
  2. Khoai @ Khoai: Dụ là đêm ny chaý phòng :))
  3. VHT BOOKS @ VHT BOOKS: Mai 11/111 đấy cả nhà ơi :))
  4. Khoai @ Khoai: Tuần mới rồi. Còn mấy cái thứ 2 nữa thì Tết nhờ?
  5. Lục Ngạn @ Lục Ngạn: Cả nhà cuối tuần vui vẻ nhé
  6. VnKienThuc @ VnKienThuc: Đã mở lại rồi anh @Butchi ơi kkkk
  7. B @ Butchi: sao chú Hide lại truất quyền post link của anh rồi :(
  8. Hide Nguyễn @ Hide Nguyễn: Shoutbox has been pruned!

Trang cá nhân

Mai 11/11 cả nhà nhé. Nhớ ghé hiệu sách nhà VHT :)
Butchi wrote on Ngọc Suka's profile.
Butchi wrote on VPP Sơn Ca's profile.
Butchi wrote on Hoàng Thị Ánh Ngọc's profile.

VnKienthuc lúc này

Không có thành viên trực tuyến.

Định hướng

Diễn đàn VnKienthuc.com là nơi thảo luận và chia sẻ về mọi kiến thức hữu ích trong học tập và cuộc sống, khởi nghiệp, kinh doanh,...
Top